haydo08 haydo08

02-12-2020
History

contestada

Which continent were involved in the triangular trade routes?

Respuesta :

paytonmariadakota1 paytonmariadakota1

02-12-2020

The triangle trade involved three continents, Europe, Africa, and America.

Answer Link

Otras preguntas

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

A study involving _____ cultures found that there is variability of personalities between cultures. A. 15 B. 31 C. 51 D. 101

Which case resulted in the ruling that intelligence tests could not be used to place black children in special classes in california?

help asap, what is the sum of the polynomials? (6x+ 7+ x^2) + (2x^2 -13)

Please help me. I'll respect you forever! ( I'll give brainliest at the best) a) In a game, one gains 5 points for every won round and loses 3 points otherwise

Floridian Zora Neal Hurston was a famous

Which equation represents the reaction of a weak acid with water? HCl + H2O H3O+ + Cl- HCO3– + H2O H2CO3 + OH– H2O H + + OH- HCOOH + H2O H3O+ + HCOO-

PLEASE HELP What happens to the particles in water as the water is heated and turns to vapor? (2 points) The particles move more quickly. The particles are des

describe the texture of the inner stomach? Why is the lining designed this way?

Which of the following bonds is the strongest? H-F C-CI C=O N≡N