netoisbeautiful6887 netoisbeautiful6887

04-06-2018
Mathematics

contestada

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Respuesta :

Аноним Аноним

04-06-2018

We use the identity sin (A - B) = sin A cos B - cos B sin A

so the above = sin (11pi/12 - pi/6) = sin 3pi/4 = 1 / sqrt2 answer

Answer Link

Otras preguntas

Which major world religion teaches that people will achieve freedom by following the Eightfold Path? a. Buddhism b. Christianity c. Islam d. Judaism

Tommy is making a picture graph to show his friends favorite kind of music. he plans to use one musical note to represent 2 people How many notes will he use

How do all multicellular organisms begin? A. as complex organisms B. as a single cell C. by expanding the size of their cells D. by creating all th

Every mineral is an element or compound given example of a mineral that is an element and a mineral that is compound

What is the greatest whole number that rounds to 67,400? What is the least whole number?

Which of the following statements about race is false? A. Race is based on physical characteristics. B. Race is socially constructed. C. Race has a biological b

0.55% as fraction in simplest form

What does the product of any whole-number factor multiplied by 100 always have ? Explain

What is the product of 4 2/3 and 11 1/4? A. 8 3/7 B. 52 1/2 C. 44 2/12 D. 56/135

Solve For V 2v + 18 = 16 - 4 ( v + 7 )