Askeushdnrdd Askeushdnrdd

03-11-2021
Mathematics

contestada

The length of a rectangle is one more than five times the width. Express the perimeter of the rectangle in
simplest fórm.

Respuesta :

reinhard10158 reinhard10158

03-11-2021

Step-by-step explanation:

length = 5×width + 1

perimeter = 2×length + 2×width =

= 2×(5×width + 1) + 2×width =

= 10×width + 2 + 2×width = 12×width + 2

Answer Link

Otras preguntas

cosec(6b+pi/8)=sec(2b-pi/8)

An isotope of an element, atomic number Z, has a mass number 2z+4. How many neutrons are there in the nucleus of the element? *MULTIPLE CHOICE* A) Z+4 B) Z+2 C)

How is the structure of Congress different under the articles of confederation and the constitution?

explain the importance of the ECM and its involvement in cellular communication

The Texas department of public safety issues drivers licenses and identification cards that have specific security features. A valid drivers license issued afte

why do we feel cool when we spray perfume in our body

anna is shopping for a new backpack. The probability that the backpack is pink is 0.7, and teh probability that it is canvas is 0.7. the probability that it is

Cuanto es diez más diez

In the reluctan Neighbor which of the following is the best clue to the theme of the history¿

Roger ran 13.2 miles in 1.6 hours. Ana ran 10.85 miles in 1.4 hours. Who had the faster average speed? How much faster? Explain. help!